C9H11FN+ — CID 91217586
1-fluoro-2,4,7-trimethyl-1-azoniacyclohepta-1,3,5,6-tetraene (PubChem CID 91217586) has the molecular formula C9H11FN+ and a molecular weight of 152.19 g/mol. Its IUPAC name is 1-fluoro-2,4,7-trimethyl-1-azoniacyclohepta-1,3,5,6-tetraene.
| Compound Name | 1-fluoro-2,4,7-trimethyl-1-azoniacyclohepta-1,3,5,6-tetraene |
|---|---|
| PubChem CID | 91217586 |
| Molecular Formula | C9H11FN+ |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 1-fluoro-2,4,7-trimethyl-1-azoniacyclohepta-1,3,5,6-tetraene |
| SMILES | CC1=C=CC(C)=CC(C)=[N+]1F |
| InChI | InChI=1S/C9H11FN/c1-7-4-5-8(2)11(10)9(3)6-7/h4,6H,1-3H3/q+1 |
| InChIKey | BMILHNIJUPQAME-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|