C28H42N4O5S — CID 91217982
tert-butyl N-methyl-N-[1-[[4-[2-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-1,3-thiazolidin-3-yl]-4-oxobutyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 91217982) has the molecular formula C28H42N4O5S and a molecular weight of 546.73 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[1-[[4-[2-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-1,3-thiazolidin-3-yl]-4-oxobutyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[1-[[4-[2-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-1,3-thiazolidin-3-yl]-4-oxobutyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91217982 |
| Molecular Formula | C28H42N4O5S |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | tert-butyl N-methyl-N-[1-[[4-[2-methyl-2-(1,2,3,4-tetrahydronaphthalen-1-ylcarbamoyl)-1,3-thiazolidin-3-yl]-4-oxobutyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(C(=O)NCCCC(=O)N1CCSC1(C)C(=O)NC1CCCc2ccccc21)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H42N4O5S/c1-19(31(6)26(36)37-27(2,3)4)24(34)29-16-10-15-23(33)32-17-18-38-28(32,5)25(35)30-22-14-9-12-20-11-7-8-13-21(20)22/h7-8,11,13,19,22H,9-10,12,14-18H2,1-6H3,(H,29,34)(H,30,35) |
| InChIKey | JNHVSHPMWHCOPA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|