C18H12F6O2 — CID 91218434
(1S)-2,2,2-trifluoro-1-[8-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anthracen-1-yl]ethanol (PubChem CID 91218434) has the molecular formula C18H12F6O2 and a molecular weight of 374.28 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-[8-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anthracen-1-yl]ethanol.
| Compound Name | (1S)-2,2,2-trifluoro-1-[8-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anthracen-1-yl]ethanol |
|---|---|
| PubChem CID | 91218434 |
| Molecular Formula | C18H12F6O2 |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-[8-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]anthracen-1-yl]ethanol |
| SMILES | O[C@@H](c1cccc2cc3cccc([C@H](O)C(F)(F)F)c3cc12)C(F)(F)F |
| InChI | InChI=1S/C18H12F6O2/c19-17(20,21)15(25)11-5-1-3-9-7-10-4-2-6-12(14(10)8-13(9)11)16(26)18(22,23)24/h1-8,15-16,25-26H/t15-,16-/m0/s1 |
| InChIKey | MKFBIUFEEHHOJD-HOTGVXAUSA-N |
| XLogP | 5.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|