C7H15N3 — CID 91218525
2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrimidine (PubChem CID 91218525) has the molecular formula C7H15N3 and a molecular weight of 141.22 g/mol. Its IUPAC name is 2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrimidine.
| Compound Name | 2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 91218525 |
| Molecular Formula | C7H15N3 |
| Molecular Weight | 141.22 g/mol |
| Exact Mass | 141.13 |
| IUPAC Name | 2,3,4,6,7,8,9,9a-octahydro-1H-pyrazino[1,2-a]pyrimidine |
| SMILES | C1CNC2CNCCN2C1 |
| InChI | InChI=1S/C7H15N3/c1-2-9-7-6-8-3-5-10(7)4-1/h7-9H,1-6H2 |
| InChIKey | ZMVLYVFPMIREDT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.22 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |