C16H27NO2 — CID 91218766
(2R,3R,6S)-6-deca-1,3,5-trienyl-2-(hydroxymethyl)piperidin-3-ol (PubChem CID 91218766) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is (2R,3R,6S)-6-deca-1,3,5-trienyl-2-(hydroxymethyl)piperidin-3-ol.
| Compound Name | (2R,3R,6S)-6-deca-1,3,5-trienyl-2-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 91218766 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | (2R,3R,6S)-6-deca-1,3,5-trienyl-2-(hydroxymethyl)piperidin-3-ol |
| SMILES | CCCCC=CC=CC=C[C@@H]1CC[C@@H](O)[C@@H](CO)N1 |
| InChI | InChI=1S/C16H27NO2/c1-2-3-4-5-6-7-8-9-10-14-11-12-16(19)15(13-18)17-14/h5-10,14-19H,2-4,11-13H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | YVWVILBCUPRAIC-BZUAXINKSA-N |
| XLogP | 2.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|