About 5-methoxy-7,8-dimethylnon-2-enal
5-methoxy-7,8-dimethylnon-2-enal (PubChem CID 91218827) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 5-methoxy-7,8-dimethylnon-2-enal.
Molecular Properties
| Compound Name | 5-methoxy-7,8-dimethylnon-2-enal |
| PubChem CID | 91218827 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 5-methoxy-7,8-dimethylnon-2-enal |
| SMILES | COC(CC=CC=O)CC(C)C(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2)11(3)9-12(14-4)7-5-6-8-13/h5-6,8,10-12H,7,9H2,1-4H3 |
| InChIKey | RWTSSKXHCPRVSN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-7,8-dimethylnon-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7,8-dimethylnon-2-enal?
The IUPAC name of 5-methoxy-7,8-dimethylnon-2-enal (CID 91218827) is 5-methoxy-7,8-dimethylnon-2-enal.
What is the SMILES notation for 5-methoxy-7,8-dimethylnon-2-enal?
The canonical SMILES for 5-methoxy-7,8-dimethylnon-2-enal is COC(CC=CC=O)CC(C)C(C)C.
What is the InChIKey of 5-methoxy-7,8-dimethylnon-2-enal?
The InChIKey is RWTSSKXHCPRVSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-10(2)11(3)9-12(14-4)7-5-6-8-13/h5-6,8,10-12H,7,9H2,1-4H3.
What are the key properties of 5-methoxy-7,8-dimethylnon-2-enal?
5-methoxy-7,8-dimethylnon-2-enal has a molecular weight of 198.31 g/mol, XLogP of 2.83, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7,8-dimethylnon-2-enal is sourced from PubChem (CID 91218827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).