About N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide
N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide (PubChem CID 91219495) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide.
Molecular Properties
| Compound Name | N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide |
| PubChem CID | 91219495 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide |
| SMILES | CC(C)=CCCC(C)CC(=O)N(CCO)CCO |
| InChI | InChI=1S/C14H27NO3/c1-12(2)5-4-6-13(3)11-14(18)15(7-9-16)8-10-17/h5,13,16-17H,4,6-11H2,1-3H3 |
| InChIKey | OBKIPUDGAXNLHT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The IUPAC name of N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide (CID 91219495) is N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide.
What is the SMILES notation for N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The canonical SMILES for N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide is CC(C)=CCCC(C)CC(=O)N(CCO)CCO.
What is the InChIKey of N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
The InChIKey is OBKIPUDGAXNLHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO3/c1-12(2)5-4-6-13(3)11-14(18)15(7-9-16)8-10-17/h5,13,16-17H,4,6-11H2,1-3H3.
What are the key properties of N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide?
N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide has a molecular weight of 257.37 g/mol, XLogP of 1.57, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-hydroxyethyl)-3,7-dimethyloct-6-enamide is sourced from PubChem (CID 91219495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).