C20H26FN3O2 — CID 91219511
tert-butyl 2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]piperidine-1-carboxylate (PubChem CID 91219511) has the molecular formula C20H26FN3O2 and a molecular weight of 359.44 g/mol. Its IUPAC name is tert-butyl 2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91219511 |
| Molecular Formula | C20H26FN3O2 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | tert-butyl 2-[[5-(4-fluorophenyl)-1H-imidazol-2-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1Cc1ncc(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C20H26FN3O2/c1-20(2,3)26-19(25)24-11-5-4-6-16(24)12-18-22-13-17(23-18)14-7-9-15(21)10-8-14/h7-10,13,16H,4-6,11-12H2,1-3H3,(H,22,23) |
| InChIKey | SBPUSEUUFZOOHY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |