C22H22FN3O3 — CID 91219716
3-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one (PubChem CID 91219716) has the molecular formula C22H22FN3O3 and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one.
| Compound Name | 3-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 91219716 |
| Molecular Formula | C22H22FN3O3 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 3-[[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)-3-fluorophenyl]iminomethyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccccc2C1/C=N/c1ccc(N2CCC3(CC2)OCCO3)c(F)c1 |
| InChI | InChI=1S/C22H22FN3O3/c23-18-13-15(24-14-17-16-3-1-2-4-19(16)25-21(17)27)5-6-20(18)26-9-7-22(8-10-26)28-11-12-29-22/h1-6,13-14,17H,7-12H2,(H,25,27)/b24-14+ |
| InChIKey | QDJYUZDAJHZLGQ-ZVHZXABRSA-N |
| XLogP | 3.61 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|