About ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate
ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate (PubChem CID 91219745) has the molecular formula C14H14O5S
and a molecular weight of 294.33 g/mol. Its IUPAC name is ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate |
| PubChem CID | 91219745 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate |
| SMILES | CCOC(=O)C1OC(=O)C(=O)C1SCc1ccccc1 |
| InChI | InChI=1S/C14H14O5S/c1-2-18-14(17)11-12(10(15)13(16)19-11)20-8-9-6-4-3-5-7-9/h3-7,11-12H,2,8H2,1H3 |
| InChIKey | XDUBXVPRQKZXDD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate?
The IUPAC name of ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate (CID 91219745) is ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate.
What is the SMILES notation for ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate?
The canonical SMILES for ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate is CCOC(=O)C1OC(=O)C(=O)C1SCc1ccccc1.
What is the InChIKey of ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate?
The InChIKey is XDUBXVPRQKZXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5S/c1-2-18-14(17)11-12(10(15)13(16)19-11)20-8-9-6-4-3-5-7-9/h3-7,11-12H,2,8H2,1H3.
What are the key properties of ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate?
ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate has a molecular weight of 294.33 g/mol, XLogP of 1.35, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-benzylsulfanyl-4,5-dioxooxolane-2-carboxylate is sourced from PubChem (CID 91219745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).