C44H52N6O2+2 — CID 91221053
trimethyl-[3-[3-[15-[3-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium (PubChem CID 91221053) has the molecular formula C44H52N6O2+2 and a molecular weight of 696.94 g/mol. Its IUPAC name is trimethyl-[3-[3-[15-[3-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium.
| Compound Name | trimethyl-[3-[3-[15-[3-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 91221053 |
| Molecular Formula | C44H52N6O2+2 |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.41 |
| IUPAC Name | trimethyl-[3-[3-[15-[3-[3-(trimethylazaniumyl)propoxy]phenyl]-21,22,23,24-tetrahydroporphyrin-5-yl]phenoxy]propyl]azanium |
| SMILES | C[N+](C)(C)CCCOc1cccc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3cccc(OCCC[N+](C)(C)C)c3)=c3ccc([nH]3)=Cc3ccc2[nH]3)c1 |
| InChI | InChI=1S/C44H52N6O2/c1-49(2,3)23-9-25-51-37-13-7-11-31(27-37)43-39-19-15-33(45-39)29-35-17-21-41(47-35)44(42-22-18-36(48-42)30-34-16-20-40(43)46-34)32-12-8-14-38(28-32)52-26-10-24-50(4,5)6/h7-8,11-22,27-30,45-48H,9-10,23-26H2,1-6H3/q+2 |
| InChIKey | BYBBQYMRXZXLDU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|