C21H25N3O6S2 — CID 91221471
N-(1-cyanopyrrolidin-3-yl)-2,5-dimethoxy-N-[(4-methylsulfonylphenyl)methyl]benzenesulfonamide (PubChem CID 91221471) has the molecular formula C21H25N3O6S2 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-2,5-dimethoxy-N-[(4-methylsulfonylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-2,5-dimethoxy-N-[(4-methylsulfonylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91221471 |
| Molecular Formula | C21H25N3O6S2 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-2,5-dimethoxy-N-[(4-methylsulfonylphenyl)methyl]benzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(Cc2ccc(S(C)(=O)=O)cc2)C2CCN(C#N)C2)c1 |
| InChI | InChI=1S/C21H25N3O6S2/c1-29-18-6-9-20(30-2)21(12-18)32(27,28)24(17-10-11-23(14-17)15-22)13-16-4-7-19(8-5-16)31(3,25)26/h4-9,12,17H,10-11,13-14H2,1-3H3 |
| InChIKey | SOQSMWBSFZLIRI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 117.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|