About (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate
(1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate (PubChem CID 91221539) has the molecular formula C8H16N2O4
and a molecular weight of 204.23 g/mol. Its IUPAC name is (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate.
Molecular Properties
| Compound Name | (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate |
| PubChem CID | 91221539 |
| Molecular Formula | C8H16N2O4 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate |
| SMILES | CC1(C)CCC(C)(CO[N+](=O)[O-])N1O |
| InChI | InChI=1S/C8H16N2O4/c1-7(2)4-5-8(3,9(7)11)6-14-10(12)13/h11H,4-6H2,1-3H3 |
| InChIKey | QOOVUCUEQFLDNC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate?
The IUPAC name of (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate (CID 91221539) is (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate.
What is the SMILES notation for (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate?
The canonical SMILES for (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate is CC1(C)CCC(C)(CO[N+](=O)[O-])N1O.
What is the InChIKey of (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate?
The InChIKey is QOOVUCUEQFLDNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O4/c1-7(2)4-5-8(3,9(7)11)6-14-10(12)13/h11H,4-6H2,1-3H3.
What are the key properties of (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate?
(1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate has a molecular weight of 204.23 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-hydroxy-2,5,5-trimethylpyrrolidin-2-yl)methyl nitrate is sourced from PubChem (CID 91221539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).