About (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate
(2-amino-3-butoxypropanoyl) piperazine-1-carboxylate (PubChem CID 91221571) has the molecular formula C12H23N3O4
and a molecular weight of 273.33 g/mol. Its IUPAC name is (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate.
Molecular Properties
| Compound Name | (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate |
| PubChem CID | 91221571 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate |
| SMILES | CCCCOCC(N)C(=O)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C12H23N3O4/c1-2-3-8-18-9-10(13)11(16)19-12(17)15-6-4-14-5-7-15/h10,14H,2-9,13H2,1H3 |
| InChIKey | RTBUUSKQQBVZHV-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate?
The IUPAC name of (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate (CID 91221571) is (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate.
What is the SMILES notation for (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate?
The canonical SMILES for (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate is CCCCOCC(N)C(=O)OC(=O)N1CCNCC1.
What is the InChIKey of (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate?
The InChIKey is RTBUUSKQQBVZHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O4/c1-2-3-8-18-9-10(13)11(16)19-12(17)15-6-4-14-5-7-15/h10,14H,2-9,13H2,1H3.
What are the key properties of (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate?
(2-amino-3-butoxypropanoyl) piperazine-1-carboxylate has a molecular weight of 273.33 g/mol, XLogP of -0.30, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-butoxypropanoyl) piperazine-1-carboxylate is sourced from PubChem (CID 91221571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).