C14H13N3OS3 — CID 912221
5,5-dimethyl-6-oxa-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16)-tetraene-13,15-dithione (PubChem CID 912221) has the molecular formula C14H13N3OS3 and a molecular weight of 335.48 g/mol. Its IUPAC name is 5,5-dimethyl-6-oxa-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16)-tetraene-13,15-dithione.
| Compound Name | 5,5-dimethyl-6-oxa-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16)-tetraene-13,15-dithione |
|---|---|
| PubChem CID | 912221 |
| Molecular Formula | C14H13N3OS3 |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5,5-dimethyl-6-oxa-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16)-tetraene-13,15-dithione |
| SMILES | CC1(C)Cc2nc3sc4c(=S)[nH]c(=S)[nH]c4c3cc2CO1 |
| InChI | InChI=1S/C14H13N3OS3/c1-14(2)4-8-6(5-18-14)3-7-9-10(21-12(7)15-8)11(19)17-13(20)16-9/h3H,4-5H2,1-2H3,(H2,16,17,19,20) |
| InChIKey | PTAGHEUGSJJYSE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|