C22H42O5Si — CID 91222452
methyl 5-[(4S,5R)-4-[(2S)-butan-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate (PubChem CID 91222452) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is methyl 5-[(4S,5R)-4-[(2S)-butan-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate.
| Compound Name | methyl 5-[(4S,5R)-4-[(2S)-butan-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 91222452 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | methyl 5-[(4S,5R)-4-[(2S)-butan-2-yl]-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
| SMILES | CC[C@H](C)[C@@]1(C=CCCC(=O)OC)OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O5Si/c1-11-17(2)22(15-13-12-14-19(23)24-8)18(26-21(6,7)27-22)16-25-28(9,10)20(3,4)5/h13,15,17-18H,11-12,14,16H2,1-10H3/t17-,18+,22+/m0/s1 |
| InChIKey | OTRMTQFRGWROFN-NJNPRVFISA-N |
| XLogP | 5.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|