C17H24N2O3S — CID 91223286
(1'S,4R)-1,1-dioxo-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-ol (PubChem CID 91223286) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is (1'S,4R)-1,1-dioxo-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-ol.
| Compound Name | (1'S,4R)-1,1-dioxo-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-ol |
|---|---|
| PubChem CID | 91223286 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (1'S,4R)-1,1-dioxo-2-propylspiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-ol |
| SMILES | CCCN1C[C@@]2(NS1(=O)=O)C1CC[C@H]2Cc2cc(O)ccc2C1 |
| InChI | InChI=1S/C17H24N2O3S/c1-2-7-19-11-17(18-23(19,21)22)14-4-5-15(17)9-13-10-16(20)6-3-12(13)8-14/h3,6,10,14-15,18,20H,2,4-5,7-9,11H2,1H3/t14?,15-,17+/m0/s1 |
| InChIKey | UEFXXHLCPANMDV-IGGKNEPZSA-N |
| XLogP | 1.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |