About 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one
4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one (PubChem CID 91223505) has the molecular formula C12H11O2+
and a molecular weight of 187.22 g/mol. Its IUPAC name is 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one.
Molecular Properties
| Compound Name | 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one |
| PubChem CID | 91223505 |
| Molecular Formula | C12H11O2+ |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one |
| SMILES | COc1c(C)cc(C)c2c1=CC(=O)[C+]=2 |
| InChI | InChI=1S/C12H11O2/c1-7-4-8(2)12(14-3)11-6-9(13)5-10(7)11/h4,6H,1-3H3/q+1 |
| InChIKey | SVKKEPCAUURMGJ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one?
The IUPAC name of 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one (CID 91223505) is 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one.
What is the SMILES notation for 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one?
The canonical SMILES for 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one is COc1c(C)cc(C)c2c1=CC(=O)[C+]=2.
What is the InChIKey of 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one?
The InChIKey is SVKKEPCAUURMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11O2/c1-7-4-8(2)12(14-3)11-6-9(13)5-10(7)11/h4,6H,1-3H3/q+1.
What are the key properties of 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one?
4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one has a molecular weight of 187.22 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-5,7-dimethyl-1H-inden-1-ylium-2-one is sourced from PubChem (CID 91223505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).