C24H20N2O7S — CID 91224257
(4R,5S,7R)-7-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(1,3-benzothiazol-6-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol (PubChem CID 91224257) has the molecular formula C24H20N2O7S and a molecular weight of 480.50 g/mol. Its IUPAC name is (4R,5S,7R)-7-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(1,3-benzothiazol-6-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol.
| Compound Name | (4R,5S,7R)-7-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(1,3-benzothiazol-6-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol |
|---|---|
| PubChem CID | 91224257 |
| Molecular Formula | C24H20N2O7S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | (4R,5S,7R)-7-[2-(1,3-benzodioxol-5-yloxy)ethyl]-2-(1,3-benzothiazol-6-yl)-5,6-dihydro-4H-4,7-epoxyisoindole-1,3,5-triol |
| SMILES | Oc1c2c(c(O)n1-c1ccc3ncsc3c1)[C@@]1(CCOc3ccc4c(c3)OCO4)C[C@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C24H20N2O7S/c27-15-9-24(5-6-30-13-2-4-16-17(8-13)32-11-31-16)20-19(21(15)33-24)22(28)26(23(20)29)12-1-3-14-18(7-12)34-10-25-14/h1-4,7-8,10,15,21,27-29H,5-6,9,11H2/t15-,21-,24+/m0/s1 |
| InChIKey | QPYLKGNGNNEPKT-OQHVVPOVSA-N |
| XLogP | 3.73 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |