C15H25NO4 — CID 91224686
6-ethynyl-3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole (PubChem CID 91224686) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 6-ethynyl-3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole.
| Compound Name | 6-ethynyl-3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 91224686 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 6-ethynyl-3,3-dimethoxy-4-[(2-methylpropan-2-yl)oxymethyl]-3a,5,6,6a-tetrahydro-2H-furo[3,2-b]pyrrole |
| SMILES | C#CC1CN(COC(C)(C)C)C2C1OCC2(OC)OC |
| InChI | InChI=1S/C15H25NO4/c1-7-11-8-16(10-20-14(2,3)4)13-12(11)19-9-15(13,17-5)18-6/h1,11-13H,8-10H2,2-6H3 |
| InChIKey | GJARVEUHLKFSIN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|