C18H23N3O3 — CID 91224856
6,8-dioxo-N-(2-propan-2-ylphenyl)-1,2,3,4,9,9a-hexahydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 91224856) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 6,8-dioxo-N-(2-propan-2-ylphenyl)-1,2,3,4,9,9a-hexahydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | 6,8-dioxo-N-(2-propan-2-ylphenyl)-1,2,3,4,9,9a-hexahydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 91224856 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 6,8-dioxo-N-(2-propan-2-ylphenyl)-1,2,3,4,9,9a-hexahydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)C1C(=O)CC2CNCCN2C1=O |
| InChI | InChI=1S/C18H23N3O3/c1-11(2)13-5-3-4-6-14(13)20-17(23)16-15(22)9-12-10-19-7-8-21(12)18(16)24/h3-6,11-12,16,19H,7-10H2,1-2H3,(H,20,23) |
| InChIKey | DVWIYXQTQFOLGO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|