C22H22FNO6S — CID 91225273
4-[5-(1,1-dioxothian-4-yl)-3-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-methylpyrrolidine-2,3-dione (PubChem CID 91225273) has the molecular formula C22H22FNO6S and a molecular weight of 447.48 g/mol. Its IUPAC name is 4-[5-(1,1-dioxothian-4-yl)-3-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-methylpyrrolidine-2,3-dione.
| Compound Name | 4-[5-(1,1-dioxothian-4-yl)-3-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 91225273 |
| Molecular Formula | C22H22FNO6S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | 4-[5-(1,1-dioxothian-4-yl)-3-[(4-fluorophenyl)methyl]furan-2-carbonyl]-1-methylpyrrolidine-2,3-dione |
| SMILES | CN1CC(C(=O)c2oc(C3CCS(=O)(=O)CC3)cc2Cc2ccc(F)cc2)C(=O)C1=O |
| InChI | InChI=1S/C22H22FNO6S/c1-24-12-17(20(26)22(24)27)19(25)21-15(10-13-2-4-16(23)5-3-13)11-18(30-21)14-6-8-31(28,29)9-7-14/h2-5,11,14,17H,6-10,12H2,1H3 |
| InChIKey | QTKCSIDGJNGRCJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 101.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|