About 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal
4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal (PubChem CID 91226186) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal.
Molecular Properties
| Compound Name | 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal |
| PubChem CID | 91226186 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal |
| SMILES | Cc1ccc(/C=C/C=O)cc1.Oc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C10H10O.C9H8N2O/c1-9-4-6-10(7-5-9)3-2-8-11;12-9-3-1-8(2-4-9)11-6-5-10-7-11/h2-8H,1H3;1-7,12H/b3-2+; |
| InChIKey | RQIWTKVKCUELOY-SQQVDAMQSA-N |
| XLogP | 3.79 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal?
The IUPAC name of 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal (CID 91226186) is 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal.
What is the SMILES notation for 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal?
The canonical SMILES for 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal is Cc1ccc(/C=C/C=O)cc1.Oc1ccc(-n2ccnc2)cc1.
What is the InChIKey of 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal?
The InChIKey is RQIWTKVKCUELOY-SQQVDAMQSA-N. The full InChI is InChI=1S/C10H10O.C9H8N2O/c1-9-4-6-10(7-5-9)3-2-8-11;12-9-3-1-8(2-4-9)11-6-5-10-7-11/h2-8H,1H3;1-7,12H/b3-2+;.
What are the key properties of 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal?
4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal has a molecular weight of 306.37 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazol-1-ylphenol;(E)-3-(4-methylphenyl)prop-2-enal is sourced from PubChem (CID 91226186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).