About (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene
(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene (PubChem CID 91226622) has the molecular formula C17H13N7
and a molecular weight of 315.34 g/mol. Its IUPAC name is (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene.
Molecular Properties
| Compound Name | (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene |
| PubChem CID | 91226622 |
| Molecular Formula | C17H13N7 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene |
| SMILES | c1ccc(-n2ncc3c(/N=N/Cc4ccncc4)ncnc32)cc1 |
| InChI | InChI=1S/C17H13N7/c1-2-4-14(5-3-1)24-17-15(11-22-24)16(19-12-20-17)23-21-10-13-6-8-18-9-7-13/h1-9,11-12H,10H2/b23-21+ |
| InChIKey | WMFAQTOAOLDBKU-XTQSDGFTSA-N |
| XLogP | 3.49 |
| TPSA | 81.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene?
The IUPAC name of (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene (CID 91226622) is (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene.
What is the SMILES notation for (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene?
The canonical SMILES for (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene is c1ccc(-n2ncc3c(/N=N/Cc4ccncc4)ncnc32)cc1.
What is the InChIKey of (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene?
The InChIKey is WMFAQTOAOLDBKU-XTQSDGFTSA-N. The full InChI is InChI=1S/C17H13N7/c1-2-4-14(5-3-1)24-17-15(11-22-24)16(19-12-20-17)23-21-10-13-6-8-18-9-7-13/h1-9,11-12H,10H2/b23-21+.
What are the key properties of (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene?
(1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene has a molecular weight of 315.34 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-(pyridin-4-ylmethyl)diazene is sourced from PubChem (CID 91226622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).