C16H17NO7 — CID 91226847
methyl 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-2-methoxybenzoate (PubChem CID 91226847) has the molecular formula C16H17NO7 and a molecular weight of 335.31 g/mol. Its IUPAC name is methyl 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-2-methoxybenzoate.
| Compound Name | methyl 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 91226847 |
| Molecular Formula | C16H17NO7 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | methyl 5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)methylideneamino]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(/N=C/C2C(=O)OC(C)(C)OC2=O)ccc1OC |
| InChI | InChI=1S/C16H17NO7/c1-16(2)23-14(19)11(15(20)24-16)8-17-9-5-6-12(21-3)10(7-9)13(18)22-4/h5-8,11H,1-4H3/b17-8+ |
| InChIKey | QPKVVIIQPKPPOZ-CAOOACKPSA-N |
| XLogP | 1.64 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|