C23H32O5SSi — CID 91226889
(3R,4S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxane-3,4,5-triol (PubChem CID 91226889) has the molecular formula C23H32O5SSi and a molecular weight of 448.66 g/mol. Its IUPAC name is (3R,4S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxane-3,4,5-triol.
| Compound Name | (3R,4S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 91226889 |
| Molecular Formula | C23H32O5SSi |
| Molecular Weight | 448.66 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (3R,4S,5S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methylsulfanyloxane-3,4,5-triol |
| SMILES | CSC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H32O5SSi/c1-23(2,3)30(16-11-7-5-8-12-16,17-13-9-6-10-14-17)27-15-18-19(24)20(25)21(26)22(28-18)29-4/h5-14,18-22,24-26H,15H2,1-4H3/t18?,19-,20-,21-,22?/m0/s1 |
| InChIKey | JQHCYMAUIDUDPP-GNOAVMNFSA-N |
| XLogP | 1.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.66 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|