C20H27N3O2 — CID 91227253
1-[3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-(phenylmethoxyamino)prop-2-enyl]pyrrolidin-2-one (PubChem CID 91227253) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-[3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-(phenylmethoxyamino)prop-2-enyl]pyrrolidin-2-one.
| Compound Name | 1-[3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-(phenylmethoxyamino)prop-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91227253 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-[3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-3-(phenylmethoxyamino)prop-2-enyl]pyrrolidin-2-one |
| SMILES | CN1CCC=C(C(=CCN2CCCC2=O)NOCc2ccccc2)C1 |
| InChI | InChI=1S/C20H27N3O2/c1-22-12-5-9-18(15-22)19(11-14-23-13-6-10-20(23)24)21-25-16-17-7-3-2-4-8-17/h2-4,7-9,11,21H,5-6,10,12-16H2,1H3 |
| InChIKey | OODNNZFJPNYLND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|