C14H12N2O5S4 — CID 91227566
ethyl 4,5-dioxo-3-(1,3-thiazol-2-ylsulfanyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)oxolane-2-carboxylate (PubChem CID 91227566) has the molecular formula C14H12N2O5S4 and a molecular weight of 416.53 g/mol. Its IUPAC name is ethyl 4,5-dioxo-3-(1,3-thiazol-2-ylsulfanyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)oxolane-2-carboxylate.
| Compound Name | ethyl 4,5-dioxo-3-(1,3-thiazol-2-ylsulfanyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 91227566 |
| Molecular Formula | C14H12N2O5S4 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | ethyl 4,5-dioxo-3-(1,3-thiazol-2-ylsulfanyl)-2-(1,3-thiazol-2-ylsulfanylmethyl)oxolane-2-carboxylate |
| SMILES | CCOC(=O)C1(CSc2nccs2)OC(=O)C(=O)C1Sc1nccs1 |
| InChI | InChI=1S/C14H12N2O5S4/c1-2-20-11(19)14(7-24-12-15-3-5-22-12)9(8(17)10(18)21-14)25-13-16-4-6-23-13/h3-6,9H,2,7H2,1H3 |
| InChIKey | BUWSDEKQNCNDBT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|