C26H28N10O4 — CID 91227586
4-[[[5-[[3-[[amino-(cyanoamino)methylidene]amino]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylic acid (PubChem CID 91227586) has the molecular formula C26H28N10O4 and a molecular weight of 544.58 g/mol. Its IUPAC name is 4-[[[5-[[3-[[amino-(cyanoamino)methylidene]amino]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylic acid.
| Compound Name | 4-[[[5-[[3-[[amino-(cyanoamino)methylidene]amino]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylic acid |
|---|---|
| PubChem CID | 91227586 |
| Molecular Formula | C26H28N10O4 |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 4-[[[5-[[3-[[amino-(cyanoamino)methylidene]amino]phenyl]methylcarbamoyl]-[1,2,4]triazolo[1,5-a]pyrimidine-7-carbonyl]amino]methyl]bicyclo[2.2.2]octane-1-carboxylic acid |
| SMILES | N#CN/C(N)=N/c1cccc(CNC(=O)c2cc(C(=O)NCC34CCC(C(=O)O)(CC3)CC4)n3ncnc3n2)c1 |
| InChI | InChI=1S/C26H28N10O4/c27-14-31-23(28)34-17-3-1-2-16(10-17)12-29-20(37)18-11-19(36-24(35-18)32-15-33-36)21(38)30-13-25-4-7-26(8-5-25,9-6-25)22(39)40/h1-3,10-11,15H,4-9,12-13H2,(H,29,37)(H,30,38)(H,39,40)(H3,28,31,34) |
| InChIKey | AYERXTVNNNLZAF-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 212.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|