About 3-methyl-4aH-isochromene
3-methyl-4aH-isochromene (PubChem CID 91227635) has the molecular formula C10H10O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-methyl-4aH-isochromene.
Molecular Properties
| Compound Name | 3-methyl-4aH-isochromene |
| PubChem CID | 91227635 |
| Molecular Formula | C10H10O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | 3-methyl-4aH-isochromene |
| SMILES | CC1=CC2C=CC=CC2=CO1 |
| InChI | InChI=1S/C10H10O/c1-8-6-9-4-2-3-5-10(9)7-11-8/h2-7,9H,1H3 |
| InChIKey | NULPCLSRJOAKDC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-4aH-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4aH-isochromene?
The IUPAC name of 3-methyl-4aH-isochromene (CID 91227635) is 3-methyl-4aH-isochromene.
What is the SMILES notation for 3-methyl-4aH-isochromene?
The canonical SMILES for 3-methyl-4aH-isochromene is CC1=CC2C=CC=CC2=CO1.
What is the InChIKey of 3-methyl-4aH-isochromene?
The InChIKey is NULPCLSRJOAKDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O/c1-8-6-9-4-2-3-5-10(9)7-11-8/h2-7,9H,1H3.
What are the key properties of 3-methyl-4aH-isochromene?
3-methyl-4aH-isochromene has a molecular weight of 146.19 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4aH-isochromene is sourced from PubChem (CID 91227635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).