About 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid
4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid (PubChem CID 91228121) has the molecular formula C15H11I2NO3
and a molecular weight of 507.07 g/mol. Its IUPAC name is 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid.
Molecular Properties
| Compound Name | 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid |
| PubChem CID | 91228121 |
| Molecular Formula | C15H11I2NO3 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.88 |
| IUPAC Name | 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid |
| SMILES | Cc1c(I)cc(/C=N\Oc2ccc(C(=O)O)cc2)cc1I |
| InChI | InChI=1S/C15H11I2NO3/c1-9-13(16)6-10(7-14(9)17)8-18-21-12-4-2-11(3-5-12)15(19)20/h2-8H,1H3,(H,19,20)/b18-8- |
| InChIKey | JOJBQXFXSDHLCQ-LSCVHKIXSA-N |
| XLogP | 4.32 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid?
The IUPAC name of 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid (CID 91228121) is 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid.
What is the SMILES notation for 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid?
The canonical SMILES for 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid is Cc1c(I)cc(/C=N\Oc2ccc(C(=O)O)cc2)cc1I.
What is the InChIKey of 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid?
The InChIKey is JOJBQXFXSDHLCQ-LSCVHKIXSA-N. The full InChI is InChI=1S/C15H11I2NO3/c1-9-13(16)6-10(7-14(9)17)8-18-21-12-4-2-11(3-5-12)15(19)20/h2-8H,1H3,(H,19,20)/b18-8-.
What are the key properties of 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid?
4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid has a molecular weight of 507.07 g/mol, XLogP of 4.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-(3,5-diiodo-4-methylphenyl)methylideneamino]oxybenzoic acid is sourced from PubChem (CID 91228121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).