C15H24O — CID 91228536
(1R,2S,4R,5S)-2,4,8-trimethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol (PubChem CID 91228536) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (1R,2S,4R,5S)-2,4,8-trimethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol.
| Compound Name | (1R,2S,4R,5S)-2,4,8-trimethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol |
|---|---|
| PubChem CID | 91228536 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (1R,2S,4R,5S)-2,4,8-trimethyl-5-prop-1-en-2-ylbicyclo[3.3.1]non-7-en-2-ol |
| SMILES | C=C(C)[C@@]12CC=C(C)[C@@H](C1)[C@@](C)(O)C[C@H]2C |
| InChI | InChI=1S/C15H24O/c1-10(2)15-7-6-11(3)13(9-15)14(5,16)8-12(15)4/h6,12-13,16H,1,7-9H2,2-5H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | XOYXUSREYADYSD-APIJFGDWSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|