C32H36N4O5 — CID 91228809
1-[5-[bis(1,3-benzodioxol-5-ylmethylamino)methyl]-1-butyl-2-phenylimidazol-4-yl]ethanol (PubChem CID 91228809) has the molecular formula C32H36N4O5 and a molecular weight of 556.66 g/mol. Its IUPAC name is 1-[5-[bis(1,3-benzodioxol-5-ylmethylamino)methyl]-1-butyl-2-phenylimidazol-4-yl]ethanol.
| Compound Name | 1-[5-[bis(1,3-benzodioxol-5-ylmethylamino)methyl]-1-butyl-2-phenylimidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 91228809 |
| Molecular Formula | C32H36N4O5 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 1-[5-[bis(1,3-benzodioxol-5-ylmethylamino)methyl]-1-butyl-2-phenylimidazol-4-yl]ethanol |
| SMILES | CCCCn1c(-c2ccccc2)nc(C(C)O)c1C(NCc1ccc2c(c1)OCO2)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H36N4O5/c1-3-4-14-36-30(29(21(2)37)35-32(36)24-8-6-5-7-9-24)31(33-17-22-10-12-25-27(15-22)40-19-38-25)34-18-23-11-13-26-28(16-23)41-20-39-26/h5-13,15-16,21,31,33-34,37H,3-4,14,17-20H2,1-2H3 |
| InChIKey | YCVHGEYJPVDYFZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|