C43H16F15N5 — CID 91228819
5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin (PubChem CID 91228819) has the molecular formula C43H16F15N5 and a molecular weight of 887.61 g/mol. Its IUPAC name is 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91228819 |
| Molecular Formula | C43H16F15N5 |
| Molecular Weight | 887.61 g/mol |
| Exact Mass | 887.12 |
| IUPAC Name | 5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-20-pyridin-4-yl-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1c(F)c(F)c(C2=c3ccc([nH]3)=C(c3ccncc3)c3ccc([nH]3)C(c3c(F)c(F)c(F)c(F)c3F)=c3ccc([nH]3)=C(c3c(F)c(F)c(F)c(F)c3F)c3ccc2[nH]3)c(F)c1F |
| InChI | InChI=1S/C43H16F15N5/c44-29-26(30(45)36(51)41(56)35(29)50)23-16-3-1-14(60-16)22(13-9-11-59-12-10-13)15-2-4-17(61-15)24(27-31(46)37(52)42(57)38(53)32(27)47)19-6-8-21(63-19)25(20-7-5-18(23)62-20)28-33(48)39(54)43(58)40(55)34(28)49/h1-12,60-63H |
| InChIKey | DXBYVJRNAFMZHB-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 76.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.61 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|