About 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile
3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile (PubChem CID 91228874) has the molecular formula C16H16N4O2
and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile |
| PubChem CID | 91228874 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile |
| SMILES | [H]/N=c1\c(C#N)c2c(nn1-c1c(C)cccc1OC)COCC2 |
| InChI | InChI=1S/C16H16N4O2/c1-10-4-3-5-14(21-2)15(10)20-16(18)12(8-17)11-6-7-22-9-13(11)19-20/h3-5,18H,6-7,9H2,1-2H3/b18-16+ |
| InChIKey | NTTYUAQRXWNEKV-FBMGVBCBSA-N |
| XLogP | 1.61 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile?
The IUPAC name of 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile (CID 91228874) is 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile.
What is the SMILES notation for 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile?
The canonical SMILES for 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile is [H]/N=c1\c(C#N)c2c(nn1-c1c(C)cccc1OC)COCC2.
What is the InChIKey of 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile?
The InChIKey is NTTYUAQRXWNEKV-FBMGVBCBSA-N. The full InChI is InChI=1S/C16H16N4O2/c1-10-4-3-5-14(21-2)15(10)20-16(18)12(8-17)11-6-7-22-9-13(11)19-20/h3-5,18H,6-7,9H2,1-2H3/b18-16+.
What are the key properties of 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile?
3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile has a molecular weight of 296.33 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imino-2-(2-methoxy-6-methylphenyl)-6,8-dihydro-5H-pyrano[3,4-c]pyridazine-4-carbonitrile is sourced from PubChem (CID 91228874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).