C36H62O8 — CID 91229692
[7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-trideca-2,4-dien-2-yl-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 91229692) has the molecular formula C36H62O8 and a molecular weight of 622.88 g/mol. Its IUPAC name is [7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-trideca-2,4-dien-2-yl-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-trideca-2,4-dien-2-yl-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 91229692 |
| Molecular Formula | C36H62O8 |
| Molecular Weight | 622.88 g/mol |
| Exact Mass | 622.44 |
| IUPAC Name | [7,10-bis(1-ethoxyethoxy)-3,7-dimethyl-12-oxo-2-trideca-2,4-dien-2-yl-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCCCCCCCC=CC=C(C)C1OC(=O)CC(OC(C)OCC)CCC(C)(OC(C)OCC)C(OC(C)=O)C=CC1C |
| InChI | InChI=1S/C36H62O8/c1-10-13-14-15-16-17-18-19-20-21-27(4)35-28(5)22-23-33(41-29(6)37)36(9,44-31(8)40-12-3)25-24-32(26-34(38)43-35)42-30(7)39-11-2/h19-23,28,30-33,35H,10-18,24-26H2,1-9H3 |
| InChIKey | IERJTRSQNJDATH-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.88 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|