C21H17N6S2+ — CID 91229700
2-[2-(3,5-diphenyltetrazol-2-ium-2-yl)-1,3-thiazol-4-yl]-4,5-dimethyl-1,3-thiazole (PubChem CID 91229700) has the molecular formula C21H17N6S2+ and a molecular weight of 417.54 g/mol. Its IUPAC name is 2-[2-(3,5-diphenyltetrazol-2-ium-2-yl)-1,3-thiazol-4-yl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[2-(3,5-diphenyltetrazol-2-ium-2-yl)-1,3-thiazol-4-yl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 91229700 |
| Molecular Formula | C21H17N6S2+ |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 2-[2-(3,5-diphenyltetrazol-2-ium-2-yl)-1,3-thiazol-4-yl]-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(-c2csc(-[n+]3nc(-c4ccccc4)nn3-c3ccccc3)n2)sc1C |
| InChI | InChI=1S/C21H17N6S2/c1-14-15(2)29-20(22-14)18-13-28-21(23-18)27-25-19(16-9-5-3-6-10-16)24-26(27)17-11-7-4-8-12-17/h3-13H,1-2H3/q+1 |
| InChIKey | LPAPEUBHXCOHMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|