C33H33N2O2+ — CID 91229880
[(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate (PubChem CID 91229880) has the molecular formula C33H33N2O2+ and a molecular weight of 489.64 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate.
| Compound Name | [(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate |
|---|---|
| PubChem CID | 91229880 |
| Molecular Formula | C33H33N2O2+ |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | [(S)-[(2R,4S,5R)-1-benzyl-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] benzoate |
| SMILES | C=C[C@H]1C[N+]2(Cc3ccccc3)CC[C@H]1C[C@@H]2[C@@H](OC(=O)c1ccccc1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C33H33N2O2/c1-2-25-23-35(22-24-11-5-3-6-12-24)20-18-27(25)21-31(35)32(37-33(36)26-13-7-4-8-14-26)29-17-19-34-30-16-10-9-15-28(29)30/h2-17,19,25,27,31-32H,1,18,20-23H2/q+1/t25-,27-,31+,32-,35?/m0/s1 |
| InChIKey | WEJPPCUFVQXVHL-QMHDLPMRSA-N |
| XLogP | 6.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|