C17H33N — CID 91229920
3-buta-2,3-dien-2-yl-N,3,5,5-tetramethylnonan-1-amine (PubChem CID 91229920) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 3-buta-2,3-dien-2-yl-N,3,5,5-tetramethylnonan-1-amine.
| Compound Name | 3-buta-2,3-dien-2-yl-N,3,5,5-tetramethylnonan-1-amine |
|---|---|
| PubChem CID | 91229920 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 3-buta-2,3-dien-2-yl-N,3,5,5-tetramethylnonan-1-amine |
| SMILES | C=C=C(C)C(C)(CCNC)CC(C)(C)CCCC |
| InChI | InChI=1S/C17H33N/c1-8-10-11-16(4,5)14-17(6,12-13-18-7)15(3)9-2/h18H,2,8,10-14H2,1,3-7H3 |
| InChIKey | NHNPHJFURNVJME-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |