C19H22O5 — CID 91229998
(4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(2,3,4-trihydroxyphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one (PubChem CID 91229998) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(2,3,4-trihydroxyphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(2,3,4-trihydroxyphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
|---|---|
| PubChem CID | 91229998 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (4aS,5S)-5-hydroxy-1,4a-dimethyl-3-[(2,3,4-trihydroxyphenyl)methylidene]-5,6,7,8-tetrahydro-4H-naphthalen-2-one |
| SMILES | CC1=C2CCC[C@H](O)[C@@]2(C)CC(=Cc2ccc(O)c(O)c2O)C1=O |
| InChI | InChI=1S/C19H22O5/c1-10-13-4-3-5-15(21)19(13,2)9-12(16(10)22)8-11-6-7-14(20)18(24)17(11)23/h6-8,15,20-21,23-24H,3-5,9H2,1-2H3/t15-,19-/m0/s1 |
| InChIKey | ZLBTZWRCTZEXBF-KXBFYZLASA-N |
| XLogP | 3.03 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|