C19H20F3NO6 — CID 91230482
2,2,2-trifluoroethyl 2-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]butanoate (PubChem CID 91230482) has the molecular formula C19H20F3NO6 and a molecular weight of 415.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]butanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]butanoate |
|---|---|
| PubChem CID | 91230482 |
| Molecular Formula | C19H20F3NO6 |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[1-(4-acetyloxyphenyl)-2,5-dihydroxy-4-methylpyrrol-3-yl]butanoate |
| SMILES | CCC(C(=O)OCC(F)(F)F)c1c(C)c(O)n(-c2ccc(OC(C)=O)cc2)c1O |
| InChI | InChI=1S/C19H20F3NO6/c1-4-14(18(27)28-9-19(20,21)22)15-10(2)16(25)23(17(15)26)12-5-7-13(8-6-12)29-11(3)24/h5-8,14,25-26H,4,9H2,1-3H3 |
| InChIKey | UAZMBHGEHLPCSU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|