C16H20N2O — CID 91231117
(1R)-1-amino-13-ethylidene-9,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one (PubChem CID 91231117) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (1R)-1-amino-13-ethylidene-9,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one.
| Compound Name | (1R)-1-amino-13-ethylidene-9,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
|---|---|
| PubChem CID | 91231117 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (1R)-1-amino-13-ethylidene-9,11-dimethyl-6-azatricyclo[7.3.1.02,7]trideca-2(7),3,10-trien-5-one |
| SMILES | CC=C1C2(C)C=C(C)C[C@]1(N)c1ccc(=O)[nH]c1C2 |
| InChI | InChI=1S/C16H20N2O/c1-4-13-15(3)7-10(2)8-16(13,17)11-5-6-14(19)18-12(11)9-15/h4-7H,8-9,17H2,1-3H3,(H,18,19)/t15?,16-/m0/s1 |
| InChIKey | URABXDMCYNGKRR-LYKKTTPLSA-N |
| XLogP | 2.39 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|