C25H33N5O2 — CID 91231245
1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(2,6-dimethylmorpholin-4-yl)phenyl]urea (PubChem CID 91231245) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(2,6-dimethylmorpholin-4-yl)phenyl]urea.
| Compound Name | 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(2,6-dimethylmorpholin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 91231245 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 1-[1-[2-(dimethylamino)ethyl]indol-5-yl]-3-[4-(2,6-dimethylmorpholin-4-yl)phenyl]urea |
| SMILES | CC1CN(c2ccc(NC(=O)Nc3ccc4c(ccn4CCN(C)C)c3)cc2)CC(C)O1 |
| InChI | InChI=1S/C25H33N5O2/c1-18-16-30(17-19(2)32-18)23-8-5-21(6-9-23)26-25(31)27-22-7-10-24-20(15-22)11-12-29(24)14-13-28(3)4/h5-12,15,18-19H,13-14,16-17H2,1-4H3,(H2,26,27,31) |
| InChIKey | PPGNKVAPCLDIIU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|