C21H30N2O3 — CID 91231259
(2S)-2-[[(2S)-2-aminopropanoyl]-(2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenyl)amino]propanoic acid (PubChem CID 91231259) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-aminopropanoyl]-(2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenyl)amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-aminopropanoyl]-(2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenyl)amino]propanoic acid |
|---|---|
| PubChem CID | 91231259 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-aminopropanoyl]-(2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenyl)amino]propanoic acid |
| SMILES | C=CC(=C)C=CC=C(C)C=CC=C(C)CN(C(=O)[C@H](C)N)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H30N2O3/c1-7-15(2)10-8-11-16(3)12-9-13-17(4)14-23(19(6)21(25)26)20(24)18(5)22/h7-13,18-19H,1-2,14,22H2,3-6H3,(H,25,26)/t18-,19-/m0/s1 |
| InChIKey | QYWZANWGYWOCRO-OALUTQOASA-N |
| XLogP | 3.38 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|