C15H20FN3O3 — CID 91231352
(2S,3R,4S,5R,6R)-5-azido-3-benzyl-4-fluoro-2,3-dimethoxy-6-methyloxane (PubChem CID 91231352) has the molecular formula C15H20FN3O3 and a molecular weight of 309.34 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-5-azido-3-benzyl-4-fluoro-2,3-dimethoxy-6-methyloxane.
| Compound Name | (2S,3R,4S,5R,6R)-5-azido-3-benzyl-4-fluoro-2,3-dimethoxy-6-methyloxane |
|---|---|
| PubChem CID | 91231352 |
| Molecular Formula | C15H20FN3O3 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2S,3R,4S,5R,6R)-5-azido-3-benzyl-4-fluoro-2,3-dimethoxy-6-methyloxane |
| SMILES | CO[C@H]1O[C@H](C)[C@@H](N=[N+]=[N-])[C@H](F)[C@]1(Cc1ccccc1)OC |
| InChI | InChI=1S/C15H20FN3O3/c1-10-12(18-19-17)13(16)15(21-3,14(20-2)22-10)9-11-7-5-4-6-8-11/h4-8,10,12-14H,9H2,1-3H3/t10-,12-,13+,14+,15+/m1/s1 |
| InChIKey | BUMCRFNFHQTPEF-IKSZGEOFSA-N |
| XLogP | 3.02 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|