C14H22F2O — CID 91231528
3-(2,2-difluorobutoxy)-7-methyl-6-methylideneocta-2,4-diene (PubChem CID 91231528) has the molecular formula C14H22F2O and a molecular weight of 244.32 g/mol. Its IUPAC name is 3-(2,2-difluorobutoxy)-7-methyl-6-methylideneocta-2,4-diene.
| Compound Name | 3-(2,2-difluorobutoxy)-7-methyl-6-methylideneocta-2,4-diene |
|---|---|
| PubChem CID | 91231528 |
| Molecular Formula | C14H22F2O |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 3-(2,2-difluorobutoxy)-7-methyl-6-methylideneocta-2,4-diene |
| SMILES | C=C(C=CC(=CC)OCC(F)(F)CC)C(C)C |
| InChI | InChI=1S/C14H22F2O/c1-6-13(9-8-12(5)11(3)4)17-10-14(15,16)7-2/h6,8-9,11H,5,7,10H2,1-4H3 |
| InChIKey | OUPSEEQBGWNILU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|