C16H17ClF3NO4 — CID 91231710
ethyl 3-[1-(4-chlorophenyl)-3-methoxy-3-oxopropyl]imino-4,4,4-trifluorobutanoate (PubChem CID 91231710) has the molecular formula C16H17ClF3NO4 and a molecular weight of 379.76 g/mol. Its IUPAC name is ethyl 3-[1-(4-chlorophenyl)-3-methoxy-3-oxopropyl]imino-4,4,4-trifluorobutanoate.
| Compound Name | ethyl 3-[1-(4-chlorophenyl)-3-methoxy-3-oxopropyl]imino-4,4,4-trifluorobutanoate |
|---|---|
| PubChem CID | 91231710 |
| Molecular Formula | C16H17ClF3NO4 |
| Molecular Weight | 379.76 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | ethyl 3-[1-(4-chlorophenyl)-3-methoxy-3-oxopropyl]imino-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)C/C(=N\C(CC(=O)OC)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H17ClF3NO4/c1-3-25-15(23)9-13(16(18,19)20)21-12(8-14(22)24-2)10-4-6-11(17)7-5-10/h4-7,12H,3,8-9H2,1-2H3/b21-13+ |
| InChIKey | QKKWEJICBPXJNG-FYJGNVAPSA-N |
| XLogP | 3.90 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.76 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|