C21H20N2O4S — CID 9123178
ethyl 2-[[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetyl]amino]benzoate (PubChem CID 9123178) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl 2-[[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 9123178 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 2-[[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COc1ccc(-c2nc(C)cs2)cc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-3-26-21(25)17-6-4-5-7-18(17)23-19(24)12-27-16-10-8-15(9-11-16)20-22-14(2)13-28-20/h4-11,13H,3,12H2,1-2H3,(H,23,24) |
| InChIKey | UEOUKVYNYFXWNC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |