C9H19N2O3+ — CID 91231862
[3-carboxy-2-(methylamino)propyl]-(1-hydroxyethenyl)-dimethylazanium (PubChem CID 91231862) has the molecular formula C9H19N2O3+ and a molecular weight of 203.26 g/mol. Its IUPAC name is [3-carboxy-2-(methylamino)propyl]-(1-hydroxyethenyl)-dimethylazanium.
| Compound Name | [3-carboxy-2-(methylamino)propyl]-(1-hydroxyethenyl)-dimethylazanium |
|---|---|
| PubChem CID | 91231862 |
| Molecular Formula | C9H19N2O3+ |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | [3-carboxy-2-(methylamino)propyl]-(1-hydroxyethenyl)-dimethylazanium |
| SMILES | C=C(O)[N+](C)(C)CC(CC(=O)O)NC |
| InChI | InChI=1S/C9H18N2O3/c1-7(12)11(3,4)6-8(10-2)5-9(13)14/h8,10H,1,5-6H2,2-4H3,(H-,12,13,14)/p+1 |
| InChIKey | BFNRSUSWNGDTSX-UHFFFAOYSA-O |
| XLogP | 0.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|