C19H26O4 — CID 91232285
ethyl 2-[4-(1,4-dioxacycloundec-8-en-8-yl)phenyl]acetate (PubChem CID 91232285) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is ethyl 2-[4-(1,4-dioxacycloundec-8-en-8-yl)phenyl]acetate.
| Compound Name | ethyl 2-[4-(1,4-dioxacycloundec-8-en-8-yl)phenyl]acetate |
|---|---|
| PubChem CID | 91232285 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | ethyl 2-[4-(1,4-dioxacycloundec-8-en-8-yl)phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(C2=CCCOCCOCCC2)cc1 |
| InChI | InChI=1S/C19H26O4/c1-2-23-19(20)15-16-7-9-18(10-8-16)17-5-3-11-21-13-14-22-12-4-6-17/h5,7-10H,2-4,6,11-15H2,1H3 |
| InChIKey | MWAOTZLPAQPGKP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |